C16H25N3O3S — CID 118245352
1-[2-methyl-6-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)hexyl]pyrrolidine-2,5-dione (PubChem CID 118245352) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is 1-[2-methyl-6-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)hexyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-methyl-6-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)hexyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 118245352 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-[2-methyl-6-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)hexyl]pyrrolidine-2,5-dione |
| SMILES | CC(CCCCC1SCC2NC(=O)NC21)CN1C(=O)CCC1=O |
| InChI | InChI=1S/C16H25N3O3S/c1-10(8-19-13(20)6-7-14(19)21)4-2-3-5-12-15-11(9-23-12)17-16(22)18-15/h10-12,15H,2-9H2,1H3,(H2,17,18,22) |
| InChIKey | WLHCNOVQKRQYKL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|