C7H12OS2 — CID 130591103
5,6-dimethyl-1,4-dithiane-2-carbaldehyde (PubChem CID 130591103) has the molecular formula C7H12OS2 and a molecular weight of 176.31 g/mol. Its IUPAC name is 5,6-dimethyl-1,4-dithiane-2-carbaldehyde.
| Compound Name | 5,6-dimethyl-1,4-dithiane-2-carbaldehyde |
|---|---|
| PubChem CID | 130591103 |
| Molecular Formula | C7H12OS2 |
| Molecular Weight | 176.31 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | 5,6-dimethyl-1,4-dithiane-2-carbaldehyde |
| SMILES | CC1SCC(C=O)SC1C |
| InChI | InChI=1S/C7H12OS2/c1-5-6(2)10-7(3-8)4-9-5/h3,5-7H,4H2,1-2H3 |
| InChIKey | QSKOSGQNIXBDOG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|