C11H21NS — CID 66230766
3-ethyl-7-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine (PubChem CID 66230766) has the molecular formula C11H21NS and a molecular weight of 199.36 g/mol. Its IUPAC name is 3-ethyl-7-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine.
| Compound Name | 3-ethyl-7-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine |
|---|---|
| PubChem CID | 66230766 |
| Molecular Formula | C11H21NS |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 3-ethyl-7-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine |
| SMILES | CCC1CSC2CC(C)CCC2N1 |
| InChI | InChI=1S/C11H21NS/c1-3-9-7-13-11-6-8(2)4-5-10(11)12-9/h8-12H,3-7H2,1-2H3 |
| InChIKey | QNRFLEKJKSPNHV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |