C14H25NS — CID 114820501
3-ethylspiro[2,3,4,4a,5,6,8,8a-octahydrobenzo[b][1,4]thiazine-7,1'-cyclopentane] (PubChem CID 114820501) has the molecular formula C14H25NS and a molecular weight of 239.43 g/mol. Its IUPAC name is 3-ethylspiro[2,3,4,4a,5,6,8,8a-octahydrobenzo[b][1,4]thiazine-7,1'-cyclopentane].
| Compound Name | 3-ethylspiro[2,3,4,4a,5,6,8,8a-octahydrobenzo[b][1,4]thiazine-7,1'-cyclopentane] |
|---|---|
| PubChem CID | 114820501 |
| Molecular Formula | C14H25NS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 3-ethylspiro[2,3,4,4a,5,6,8,8a-octahydrobenzo[b][1,4]thiazine-7,1'-cyclopentane] |
| SMILES | CCC1CSC2CC3(CCCC3)CCC2N1 |
| InChI | InChI=1S/C14H25NS/c1-2-11-10-16-13-9-14(6-3-4-7-14)8-5-12(13)15-11/h11-13,15H,2-10H2,1H3 |
| InChIKey | UTFULIUGGOFQCO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |