C12H23NS — CID 66229577
4-ethyl-2-(4-methylcyclohexyl)-1,3-thiazolidine (PubChem CID 66229577) has the molecular formula C12H23NS and a molecular weight of 213.39 g/mol. Its IUPAC name is 4-ethyl-2-(4-methylcyclohexyl)-1,3-thiazolidine.
| Compound Name | 4-ethyl-2-(4-methylcyclohexyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 66229577 |
| Molecular Formula | C12H23NS |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | 4-ethyl-2-(4-methylcyclohexyl)-1,3-thiazolidine |
| SMILES | CCC1CSC(C2CCC(C)CC2)N1 |
| InChI | InChI=1S/C12H23NS/c1-3-11-8-14-12(13-11)10-6-4-9(2)5-7-10/h9-13H,3-8H2,1-2H3 |
| InChIKey | WMAAVZHJOWFXQX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |