C8H15NS — CID 66233555
2-cyclopropyl-4-methyl-1,3-thiazinane (PubChem CID 66233555) has the molecular formula C8H15NS and a molecular weight of 157.28 g/mol. Its IUPAC name is 2-cyclopropyl-4-methyl-1,3-thiazinane.
| Compound Name | 2-cyclopropyl-4-methyl-1,3-thiazinane |
|---|---|
| PubChem CID | 66233555 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 2-cyclopropyl-4-methyl-1,3-thiazinane |
| SMILES | CC1CCSC(C2CC2)N1 |
| InChI | InChI=1S/C8H15NS/c1-6-4-5-10-8(9-6)7-2-3-7/h6-9H,2-5H2,1H3 |
| InChIKey | JLXBWDMVGBEAOL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |