C10H21NS — CID 66233327
4-methyl-2-pentan-2-yl-1,3-thiazinane (PubChem CID 66233327) has the molecular formula C10H21NS and a molecular weight of 187.35 g/mol. Its IUPAC name is 4-methyl-2-pentan-2-yl-1,3-thiazinane.
| Compound Name | 4-methyl-2-pentan-2-yl-1,3-thiazinane |
|---|---|
| PubChem CID | 66233327 |
| Molecular Formula | C10H21NS |
| Molecular Weight | 187.35 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 4-methyl-2-pentan-2-yl-1,3-thiazinane |
| SMILES | CCCC(C)C1NC(C)CCS1 |
| InChI | InChI=1S/C10H21NS/c1-4-5-8(2)10-11-9(3)6-7-12-10/h8-11H,4-7H2,1-3H3 |
| InChIKey | KIYSNIAJIBXYTR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |