About (2S)-2,5-dimethylpyrrolidine;ethane
(2S)-2,5-dimethylpyrrolidine;ethane (PubChem CID 177006469) has the molecular formula C8H19N
and a molecular weight of 129.25 g/mol. Its IUPAC name is (2S)-2,5-dimethylpyrrolidine;ethane.
Molecular Properties
| Compound Name | (2S)-2,5-dimethylpyrrolidine;ethane |
| PubChem CID | 177006469 |
| Molecular Formula | C8H19N |
| Molecular Weight | 129.25 g/mol |
| Exact Mass | 129.15 |
| IUPAC Name | (2S)-2,5-dimethylpyrrolidine;ethane |
| SMILES | CC.CC1CC[C@H](C)N1 |
| InChI | InChI=1S/C6H13N.C2H6/c1-5-3-4-6(2)7-5;1-2/h5-7H,3-4H2,1-2H3;1-2H3/t5-,6?;/m0./s1 |
| InChIKey | REYNASFDUVPKML-GNVLWMSISA-N |
| XLogP | 2.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-2,5-dimethylpyrrolidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,5-dimethylpyrrolidine;ethane?
The IUPAC name of (2S)-2,5-dimethylpyrrolidine;ethane (CID 177006469) is (2S)-2,5-dimethylpyrrolidine;ethane.
What is the SMILES notation for (2S)-2,5-dimethylpyrrolidine;ethane?
The canonical SMILES for (2S)-2,5-dimethylpyrrolidine;ethane is CC.CC1CC[C@H](C)N1.
What is the InChIKey of (2S)-2,5-dimethylpyrrolidine;ethane?
The InChIKey is REYNASFDUVPKML-GNVLWMSISA-N. The full InChI is InChI=1S/C6H13N.C2H6/c1-5-3-4-6(2)7-5;1-2/h5-7H,3-4H2,1-2H3;1-2H3/t5-,6?;/m0./s1.
What are the key properties of (2S)-2,5-dimethylpyrrolidine;ethane?
(2S)-2,5-dimethylpyrrolidine;ethane has a molecular weight of 129.25 g/mol, XLogP of 2.17, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,5-dimethylpyrrolidine;ethane is sourced from PubChem (CID 177006469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).