C9H22N2 — CID 176942680
3,6-dimethylpiperidin-2-amine;ethane (PubChem CID 176942680) has the molecular formula C9H22N2 and a molecular weight of 158.29 g/mol. Its IUPAC name is 3,6-dimethylpiperidin-2-amine;ethane.
| Compound Name | 3,6-dimethylpiperidin-2-amine;ethane |
|---|---|
| PubChem CID | 176942680 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | 3,6-dimethylpiperidin-2-amine;ethane |
| SMILES | CC.CC1CCC(C)C(N)N1 |
| InChI | InChI=1S/C7H16N2.C2H6/c1-5-3-4-6(2)9-7(5)8;1-2/h5-7,9H,3-4,8H2,1-2H3;1-2H3 |
| InChIKey | JXYLSZPASHPFLP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |