C7H13F2N — CID 170328463
(2S,6R)-4,4-difluoro-2,6-dimethylpiperidine (PubChem CID 170328463) has the molecular formula C7H13F2N and a molecular weight of 149.18 g/mol. Its IUPAC name is (2S,6R)-4,4-difluoro-2,6-dimethylpiperidine.
| Compound Name | (2S,6R)-4,4-difluoro-2,6-dimethylpiperidine |
|---|---|
| PubChem CID | 170328463 |
| Molecular Formula | C7H13F2N |
| Molecular Weight | 149.18 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | (2S,6R)-4,4-difluoro-2,6-dimethylpiperidine |
| SMILES | C[C@@H]1CC(F)(F)C[C@H](C)N1 |
| InChI | InChI=1S/C7H13F2N/c1-5-3-7(8,9)4-6(2)10-5/h5-6,10H,3-4H2,1-2H3/t5-,6+ |
| InChIKey | DZSNVKSVWFYTAP-OLQVQODUSA-N |
| XLogP | 1.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.18 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |