About (1S,5R)-3,3-difluoro-6-methylbicyclo[3.1.0]hexane
(1S,5R)-3,3-difluoro-6-methylbicyclo[3.1.0]hexane (PubChem CID 159654618) has the molecular formula C7H10F2
and a molecular weight of 132.15 g/mol. Its IUPAC name is (1S,5R)-3,3-difluoro-6-methylbicyclo[3.1.0]hexane.
Analyze (1S,5R)-3,3-difluoro-6-methylbicyclo[3.1.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-3,3-difluoro-6-methylbicyclo[3.1.0]hexane?
The IUPAC name of (1S,5R)-3,3-difluoro-6-methylbicyclo[3.1.0]hexane (CID 159654618) is (1S,5R)-3,3-difluoro-6-methylbicyclo[3.1.0]hexane.
What is the SMILES notation for (1S,5R)-3,3-difluoro-6-methylbicyclo[3.1.0]hexane?
The canonical SMILES for (1S,5R)-3,3-difluoro-6-methylbicyclo[3.1.0]hexane is CC1[C@H]2CC(F)(F)C[C@@H]12.
What is the InChIKey of (1S,5R)-3,3-difluoro-6-methylbicyclo[3.1.0]hexane?
The InChIKey is MSAAEUGPYIFTHZ-GOHHTPAQSA-N. The full InChI is InChI=1S/C7H10F2/c1-4-5-2-7(8,9)3-6(4)5/h4-6H,2-3H2,1H3/t4?,5-,6+.
What are the key properties of (1S,5R)-3,3-difluoro-6-methylbicyclo[3.1.0]hexane?
(1S,5R)-3,3-difluoro-6-methylbicyclo[3.1.0]hexane has a molecular weight of 132.15 g/mol, XLogP of 2.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-3,3-difluoro-6-methylbicyclo[3.1.0]hexane is sourced from PubChem (CID 159654618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).