C7H9F2NO — CID 162605740
3,3-difluorobicyclo[3.1.0]hexane-6-carboxamide (PubChem CID 162605740) has the molecular formula C7H9F2NO and a molecular weight of 161.15 g/mol. Its IUPAC name is 3,3-difluorobicyclo[3.1.0]hexane-6-carboxamide.
| Compound Name | 3,3-difluorobicyclo[3.1.0]hexane-6-carboxamide |
|---|---|
| PubChem CID | 162605740 |
| Molecular Formula | C7H9F2NO |
| Molecular Weight | 161.15 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | 3,3-difluorobicyclo[3.1.0]hexane-6-carboxamide |
| SMILES | NC(=O)C1C2CC(F)(F)CC21 |
| InChI | InChI=1S/C7H9F2NO/c8-7(9)1-3-4(2-7)5(3)6(10)11/h3-5H,1-2H2,(H2,10,11) |
| InChIKey | ZHGBLXQAYBOMSE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.15 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |