C18H33N3O7S — CID 158212043
tert-butyl N-(2-oxoethyl)carbamate;methyl (4R)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazolidine-4-carboxylate (PubChem CID 158212043) has the molecular formula C18H33N3O7S and a molecular weight of 435.54 g/mol. Its IUPAC name is tert-butyl N-(2-oxoethyl)carbamate;methyl (4R)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazolidine-4-carboxylate.
| Compound Name | tert-butyl N-(2-oxoethyl)carbamate;methyl (4R)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 158212043 |
| Molecular Formula | C18H33N3O7S |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | tert-butyl N-(2-oxoethyl)carbamate;methyl (4R)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazolidine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)NCC=O.COC(=O)[C@@H]1CSC(CNC(=O)OC(C)(C)C)N1 |
| InChI | InChI=1S/C11H20N2O4S.C7H13NO3/c1-11(2,3)17-10(15)12-5-8-13-7(6-18-8)9(14)16-4;1-7(2,3)11-6(10)8-4-5-9/h7-8,13H,5-6H2,1-4H3,(H,12,15);5H,4H2,1-3H3,(H,8,10)/t7-,8?;/m0./s1 |
| InChIKey | GCEUAKHPCAHWGY-JPPWUZRISA-N |
| XLogP | 1.43 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|