C7H11NO4S — CID 57312911
2-ethoxycarbonyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 57312911) has the molecular formula C7H11NO4S and a molecular weight of 205.23 g/mol. Its IUPAC name is 2-ethoxycarbonyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-ethoxycarbonyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 57312911 |
| Molecular Formula | C7H11NO4S |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 2-ethoxycarbonyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCOC(=O)C1NC(C(=O)O)CS1 |
| InChI | InChI=1S/C7H11NO4S/c1-2-12-7(11)5-8-4(3-13-5)6(9)10/h4-5,8H,2-3H2,1H3,(H,9,10) |
| InChIKey | CUHKNSQDMNYEFA-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |