C7H11NO3S2 — CID 154362128
2-(3-sulfanylpropanoyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 154362128) has the molecular formula C7H11NO3S2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-(3-sulfanylpropanoyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-(3-sulfanylpropanoyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 154362128 |
| Molecular Formula | C7H11NO3S2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | 2-(3-sulfanylpropanoyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)C1CSC(C(=O)CCS)N1 |
| InChI | InChI=1S/C7H11NO3S2/c9-5(1-2-12)6-8-4(3-13-6)7(10)11/h4,6,8,12H,1-3H2,(H,10,11) |
| InChIKey | BUZUHDJKQXPATC-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|