About 1,3-thiazolidine-2,4-dicarboxylic acid;hydrate
1,3-thiazolidine-2,4-dicarboxylic acid;hydrate (PubChem CID 22302524) has the molecular formula C5H9NO5S
and a molecular weight of 195.20 g/mol. Its IUPAC name is 1,3-thiazolidine-2,4-dicarboxylic acid;hydrate.
Molecular Properties
| Compound Name | 1,3-thiazolidine-2,4-dicarboxylic acid;hydrate |
| PubChem CID | 22302524 |
| Molecular Formula | C5H9NO5S |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | 1,3-thiazolidine-2,4-dicarboxylic acid;hydrate |
| SMILES | O.O=C(O)C1CSC(C(=O)O)N1 |
| InChI | InChI=1S/C5H7NO4S.H2O/c7-4(8)2-1-11-3(6-2)5(9)10;/h2-3,6H,1H2,(H,7,8)(H,9,10);1H2 |
| InChIKey | FGQGIULHTAHHEZ-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 118.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-thiazolidine-2,4-dicarboxylic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-thiazolidine-2,4-dicarboxylic acid;hydrate?
The IUPAC name of 1,3-thiazolidine-2,4-dicarboxylic acid;hydrate (CID 22302524) is 1,3-thiazolidine-2,4-dicarboxylic acid;hydrate.
What is the SMILES notation for 1,3-thiazolidine-2,4-dicarboxylic acid;hydrate?
The canonical SMILES for 1,3-thiazolidine-2,4-dicarboxylic acid;hydrate is O.O=C(O)C1CSC(C(=O)O)N1.
What is the InChIKey of 1,3-thiazolidine-2,4-dicarboxylic acid;hydrate?
The InChIKey is FGQGIULHTAHHEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO4S.H2O/c7-4(8)2-1-11-3(6-2)5(9)10;/h2-3,6H,1H2,(H,7,8)(H,9,10);1H2.
What are the key properties of 1,3-thiazolidine-2,4-dicarboxylic acid;hydrate?
1,3-thiazolidine-2,4-dicarboxylic acid;hydrate has a molecular weight of 195.20 g/mol, XLogP of -1.64, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-thiazolidine-2,4-dicarboxylic acid;hydrate is sourced from PubChem (CID 22302524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).