C10H17NO2S — CID 2732227
2-cyclohexyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 2732227) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is 2-cyclohexyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-cyclohexyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 2732227 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 2-cyclohexyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)C1CSC(C2CCCCC2)N1 |
| InChI | InChI=1S/C10H17NO2S/c12-10(13)8-6-14-9(11-8)7-4-2-1-3-5-7/h7-9,11H,1-6H2,(H,12,13) |
| InChIKey | NGEBHQSOFHCRQW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |