C9H15NO3S — CID 62386285
(4R)-2-(oxan-4-yl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 62386285) has the molecular formula C9H15NO3S and a molecular weight of 217.29 g/mol. Its IUPAC name is (4R)-2-(oxan-4-yl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-2-(oxan-4-yl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 62386285 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | (4R)-2-(oxan-4-yl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CSC(C2CCOCC2)N1 |
| InChI | InChI=1S/C9H15NO3S/c11-9(12)7-5-14-8(10-7)6-1-3-13-4-2-6/h6-8,10H,1-5H2,(H,11,12)/t7-,8?/m0/s1 |
| InChIKey | GNGZRMMEOSFJAG-JAMMHHFISA-N |
| XLogP | 0.53 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |