About (4R)-2-(oxan-4-yl)-1,3-thiazolidine-4-carboxylic acid
(4R)-2-(oxan-4-yl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 62386285) has the molecular formula C9H15NO3S
and a molecular weight of 217.29 g/mol. Its IUPAC name is (4R)-2-(oxan-4-yl)-1,3-thiazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | (4R)-2-(oxan-4-yl)-1,3-thiazolidine-4-carboxylic acid |
| PubChem CID | 62386285 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | (4R)-2-(oxan-4-yl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CSC(C2CCOCC2)N1 |
| InChI | InChI=1S/C9H15NO3S/c11-9(12)7-5-14-8(10-7)6-1-3-13-4-2-6/h6-8,10H,1-5H2,(H,11,12)/t7-,8?/m0/s1 |
| InChIKey | GNGZRMMEOSFJAG-JAMMHHFISA-N |
| XLogP | 0.53 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4R)-2-(oxan-4-yl)-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-(oxan-4-yl)-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of (4R)-2-(oxan-4-yl)-1,3-thiazolidine-4-carboxylic acid (CID 62386285) is (4R)-2-(oxan-4-yl)-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for (4R)-2-(oxan-4-yl)-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for (4R)-2-(oxan-4-yl)-1,3-thiazolidine-4-carboxylic acid is O=C(O)[C@@H]1CSC(C2CCOCC2)N1.
What is the InChIKey of (4R)-2-(oxan-4-yl)-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is GNGZRMMEOSFJAG-JAMMHHFISA-N. The full InChI is InChI=1S/C9H15NO3S/c11-9(12)7-5-14-8(10-7)6-1-3-13-4-2-6/h6-8,10H,1-5H2,(H,11,12)/t7-,8?/m0/s1.
What are the key properties of (4R)-2-(oxan-4-yl)-1,3-thiazolidine-4-carboxylic acid?
(4R)-2-(oxan-4-yl)-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 217.29 g/mol, XLogP of 0.53, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-(oxan-4-yl)-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 62386285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).