C7H11NO4 — CID 126584428
(6S)-piperidine-2,6-dicarboxylic acid (PubChem CID 126584428) has the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. Its IUPAC name is (6S)-piperidine-2,6-dicarboxylic acid.
| Compound Name | (6S)-piperidine-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 126584428 |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | (6S)-piperidine-2,6-dicarboxylic acid |
| SMILES | O=C(O)C1CCC[C@@H](C(=O)O)N1 |
| InChI | InChI=1S/C7H11NO4/c9-6(10)4-2-1-3-5(8-4)7(11)12/h4-5,8H,1-3H2,(H,9,10)(H,11,12)/t4-,5?/m0/s1 |
| InChIKey | SOOPBZRXJMNXTF-ROLXFIACSA-N |
| XLogP | -0.33 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |