(6S)-piperidine-2,6-dicarboxylic acid

C7H11NO4 — CID 126584428

IUPAC(6S)-piperidine-2,6-dicarboxylic acid
SMILESO=C(O)C1CCC[C@@H](C(=O)O)N1
InChIInChI=1S/C7H11NO4/c9-6(10)4-2-1-3-5(8-4)7(11)12/h4-5,8H,1-3H2,(H,9,10)(H,11,12)/t4-,5?/m0/s1
InChIKeySOOPBZRXJMNXTF-ROLXFIACSA-N
MW173.17 g/mol
LogP-0.33
Rot. Bonds2

About (6S)-piperidine-2,6-dicarboxylic acid

(6S)-piperidine-2,6-dicarboxylic acid (PubChem CID 126584428) has the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. Its IUPAC name is (6S)-piperidine-2,6-dicarboxylic acid.

Molecular Properties

Compound Name(6S)-piperidine-2,6-dicarboxylic acid
PubChem CID126584428
Molecular FormulaC7H11NO4
Molecular Weight173.17 g/mol
Exact Mass173.07
IUPAC Name(6S)-piperidine-2,6-dicarboxylic acid
SMILESO=C(O)C1CCC[C@@H](C(=O)O)N1
InChIInChI=1S/C7H11NO4/c9-6(10)4-2-1-3-5(8-4)7(11)12/h4-5,8H,1-3H2,(H,9,10)(H,11,12)/t4-,5?/m0/s1
InChIKeySOOPBZRXJMNXTF-ROLXFIACSA-N
XLogP-0.33
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.17
LogP ≤ 5-0.33
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (6S)-piperidine-2,6-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6S)-piperidine-2,6-dicarboxylic acid?
The IUPAC name of (6S)-piperidine-2,6-dicarboxylic acid (CID 126584428) is (6S)-piperidine-2,6-dicarboxylic acid.
What is the SMILES notation for (6S)-piperidine-2,6-dicarboxylic acid?
The canonical SMILES for (6S)-piperidine-2,6-dicarboxylic acid is O=C(O)C1CCC[C@@H](C(=O)O)N1.
What is the InChIKey of (6S)-piperidine-2,6-dicarboxylic acid?
The InChIKey is SOOPBZRXJMNXTF-ROLXFIACSA-N. The full InChI is InChI=1S/C7H11NO4/c9-6(10)4-2-1-3-5(8-4)7(11)12/h4-5,8H,1-3H2,(H,9,10)(H,11,12)/t4-,5?/m0/s1.
What are the key properties of (6S)-piperidine-2,6-dicarboxylic acid?
(6S)-piperidine-2,6-dicarboxylic acid has a molecular weight of 173.17 g/mol, XLogP of -0.33, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-piperidine-2,6-dicarboxylic acid is sourced from PubChem (CID 126584428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).