About ethyl thiirane-2-carboxylate
ethyl thiirane-2-carboxylate (PubChem CID 12518686) has the molecular formula C5H8O2S
and a molecular weight of 132.18 g/mol. Its IUPAC name is ethyl thiirane-2-carboxylate.
Molecular Properties
| Compound Name | ethyl thiirane-2-carboxylate |
| PubChem CID | 12518686 |
| Molecular Formula | C5H8O2S |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.02 |
| IUPAC Name | ethyl thiirane-2-carboxylate |
| SMILES | CCOC(=O)C1CS1 |
| InChI | InChI=1S/C5H8O2S/c1-2-7-5(6)4-3-8-4/h4H,2-3H2,1H3 |
| InChIKey | JJGUBIFKGODNPJ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethyl thiirane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl thiirane-2-carboxylate?
The IUPAC name of ethyl thiirane-2-carboxylate (CID 12518686) is ethyl thiirane-2-carboxylate.
What is the SMILES notation for ethyl thiirane-2-carboxylate?
The canonical SMILES for ethyl thiirane-2-carboxylate is CCOC(=O)C1CS1.
What is the InChIKey of ethyl thiirane-2-carboxylate?
The InChIKey is JJGUBIFKGODNPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2S/c1-2-7-5(6)4-3-8-4/h4H,2-3H2,1H3.
What are the key properties of ethyl thiirane-2-carboxylate?
ethyl thiirane-2-carboxylate has a molecular weight of 132.18 g/mol, XLogP of 0.66, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl thiirane-2-carboxylate is sourced from PubChem (CID 12518686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).