C10H16O4S — CID 66591294
diethyl (2S,5R)-thiolane-2,5-dicarboxylate (PubChem CID 66591294) has the molecular formula C10H16O4S and a molecular weight of 232.30 g/mol. Its IUPAC name is diethyl (2S,5R)-thiolane-2,5-dicarboxylate.
| Compound Name | diethyl (2S,5R)-thiolane-2,5-dicarboxylate |
|---|---|
| PubChem CID | 66591294 |
| Molecular Formula | C10H16O4S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | diethyl (2S,5R)-thiolane-2,5-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1CC[C@H](C(=O)OCC)S1 |
| InChI | InChI=1S/C10H16O4S/c1-3-13-9(11)7-5-6-8(15-7)10(12)14-4-2/h7-8H,3-6H2,1-2H3/t7-,8+ |
| InChIKey | CTAFSRRKAWJZRQ-OCAPTIKFSA-N |
| XLogP | 1.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |