C15H17ClO6S — CID 102569031
diethyl 2-(4-chlorophenyl)sulfonylcyclopropane-1,1-dicarboxylate (PubChem CID 102569031) has the molecular formula C15H17ClO6S and a molecular weight of 360.82 g/mol. Its IUPAC name is diethyl 2-(4-chlorophenyl)sulfonylcyclopropane-1,1-dicarboxylate.
| Compound Name | diethyl 2-(4-chlorophenyl)sulfonylcyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102569031 |
| Molecular Formula | C15H17ClO6S |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | diethyl 2-(4-chlorophenyl)sulfonylcyclopropane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H17ClO6S/c1-3-21-13(17)15(14(18)22-4-2)9-12(15)23(19,20)11-7-5-10(16)6-8-11/h5-8,12H,3-4,9H2,1-2H3 |
| InChIKey | IWNZBBYDESTGED-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|