C18H16Cl2O4 — CID 23239564
ethyl (2R,4R,5R)-2,5-bis(4-chlorophenyl)-1,3-dioxolane-4-carboxylate (PubChem CID 23239564) has the molecular formula C18H16Cl2O4 and a molecular weight of 367.23 g/mol. Its IUPAC name is ethyl (2R,4R,5R)-2,5-bis(4-chlorophenyl)-1,3-dioxolane-4-carboxylate.
| Compound Name | ethyl (2R,4R,5R)-2,5-bis(4-chlorophenyl)-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 23239564 |
| Molecular Formula | C18H16Cl2O4 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | ethyl (2R,4R,5R)-2,5-bis(4-chlorophenyl)-1,3-dioxolane-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1O[C@H](c2ccc(Cl)cc2)O[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16Cl2O4/c1-2-22-17(21)16-15(11-3-7-13(19)8-4-11)23-18(24-16)12-5-9-14(20)10-6-12/h3-10,15-16,18H,2H2,1H3/t15-,16-,18-/m1/s1 |
| InChIKey | UTMIWHXYHSUJLM-JFIYKMOQSA-N |
| XLogP | 4.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |