C11H12ClNO4 — CID 165157133
ethyl (2S,3R)-3-(6-chloro-3-methoxy-2-pyridinyl)oxirane-2-carboxylate (PubChem CID 165157133) has the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. Its IUPAC name is ethyl (2S,3R)-3-(6-chloro-3-methoxy-2-pyridinyl)oxirane-2-carboxylate.
| Compound Name | ethyl (2S,3R)-3-(6-chloro-3-methoxy-2-pyridinyl)oxirane-2-carboxylate |
|---|---|
| PubChem CID | 165157133 |
| Molecular Formula | C11H12ClNO4 |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | ethyl (2S,3R)-3-(6-chloro-3-methoxy-2-pyridinyl)oxirane-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1O[C@@H]1c1nc(Cl)ccc1OC |
| InChI | InChI=1S/C11H12ClNO4/c1-3-16-11(14)10-9(17-10)8-6(15-2)4-5-7(12)13-8/h4-5,9-10H,3H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | DXVASTXFKCYJMP-ZJUUUORDSA-N |
| XLogP | 1.75 |
| TPSA | 60.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|