C20H28BClO4S2 — CID 102303405
O-ethyl [5-(4-chlorophenyl)-5-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-yl]sulfanylmethanethioate (PubChem CID 102303405) has the molecular formula C20H28BClO4S2 and a molecular weight of 442.84 g/mol. Its IUPAC name is O-ethyl [5-(4-chlorophenyl)-5-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-yl]sulfanylmethanethioate.
| Compound Name | O-ethyl [5-(4-chlorophenyl)-5-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-yl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 102303405 |
| Molecular Formula | C20H28BClO4S2 |
| Molecular Weight | 442.84 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | O-ethyl [5-(4-chlorophenyl)-5-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-yl]sulfanylmethanethioate |
| SMILES | CCOC(=S)SC(CCC(=O)c1ccc(Cl)cc1)CB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H28BClO4S2/c1-6-24-18(27)28-16(13-21-25-19(2,3)20(4,5)26-21)11-12-17(23)14-7-9-15(22)10-8-14/h7-10,16H,6,11-13H2,1-5H3 |
| InChIKey | VYXVHQUZCFQYMA-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.84 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|