C14H13ClF3NO4 — CID 172946966
ethyl 2-[(2Z)-2-(4-chlorophenyl)-2-hydroxyiminoethyl]-4,4,4-trifluoro-3-oxobutanoate (PubChem CID 172946966) has the molecular formula C14H13ClF3NO4 and a molecular weight of 351.71 g/mol. Its IUPAC name is ethyl 2-[(2Z)-2-(4-chlorophenyl)-2-hydroxyiminoethyl]-4,4,4-trifluoro-3-oxobutanoate.
| Compound Name | ethyl 2-[(2Z)-2-(4-chlorophenyl)-2-hydroxyiminoethyl]-4,4,4-trifluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 172946966 |
| Molecular Formula | C14H13ClF3NO4 |
| Molecular Weight | 351.71 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | ethyl 2-[(2Z)-2-(4-chlorophenyl)-2-hydroxyiminoethyl]-4,4,4-trifluoro-3-oxobutanoate |
| SMILES | CCOC(=O)C(C/C(=N/O)c1ccc(Cl)cc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C14H13ClF3NO4/c1-2-23-13(21)10(12(20)14(16,17)18)7-11(19-22)8-3-5-9(15)6-4-8/h3-6,10,22H,2,7H2,1H3/b19-11- |
| InChIKey | LMMQPOVFFMDRBA-ODLFYWEKSA-N |
| XLogP | 3.22 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.71 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|