C18H34B2O6 — CID 162408317
2-[(E)-1-ethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enoxy]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 162408317) has the molecular formula C18H34B2O6 and a molecular weight of 368.09 g/mol. Its IUPAC name is 2-[(E)-1-ethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enoxy]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(E)-1-ethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enoxy]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 162408317 |
| Molecular Formula | C18H34B2O6 |
| Molecular Weight | 368.09 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 2-[(E)-1-ethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enoxy]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCO/C(=C/C(C)B1OC(C)(C)C(C)(C)O1)OB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H34B2O6/c1-11-21-14(22-20-25-17(7,8)18(9,10)26-20)12-13(2)19-23-15(3,4)16(5,6)24-19/h12-13H,11H2,1-10H3/b14-12- |
| InChIKey | OOQPATYDNNCDFJ-OWBHPGMISA-N |
| XLogP | 3.95 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.09 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|