C22H34B2O5 — CID 177491949
4,4,5,5-tetramethyl-2-[(E)-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-2-yl]oxy-1,3,2-dioxaborolane (PubChem CID 177491949) has the molecular formula C22H34B2O5 and a molecular weight of 400.13 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(E)-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-2-yl]oxy-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(E)-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-2-yl]oxy-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 177491949 |
| Molecular Formula | C22H34B2O5 |
| Molecular Weight | 400.13 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(E)-4-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-2-yl]oxy-1,3,2-dioxaborolane |
| SMILES | C/C(=C\C(B1OC(C)(C)C(C)(C)O1)c1ccccc1)OB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H34B2O5/c1-16(25-24-28-21(6,7)22(8,9)29-24)15-18(17-13-11-10-12-14-17)23-26-19(2,3)20(4,5)27-23/h10-15,18H,1-9H3/b16-15+ |
| InChIKey | JSCYCVIGARHTGY-FOCLMDBBSA-N |
| XLogP | 4.91 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.13 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|