C16H30B2O5 — CID 101353112
4,4,5,5-tetramethyl-2-[(Z)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-2-yl]oxy-1,3,2-dioxaborolane (PubChem CID 101353112) has the molecular formula C16H30B2O5 and a molecular weight of 324.04 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(Z)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-2-yl]oxy-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(Z)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-2-yl]oxy-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 101353112 |
| Molecular Formula | C16H30B2O5 |
| Molecular Weight | 324.04 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(Z)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-2-yl]oxy-1,3,2-dioxaborolane |
| SMILES | C/C(=C/CB1OC(C)(C)C(C)(C)O1)OB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H30B2O5/c1-12(19-18-22-15(6,7)16(8,9)23-18)10-11-17-20-13(2,3)14(4,5)21-17/h10H,11H2,1-9H3/b12-10- |
| InChIKey | XAVXELZTYFKYQO-BENRWUELSA-N |
| XLogP | 3.59 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.04 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|