C10H17BO4 — CID 57416202
(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl) but-3-enoate (PubChem CID 57416202) has the molecular formula C10H17BO4 and a molecular weight of 212.05 g/mol. Its IUPAC name is (4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl) but-3-enoate.
| Compound Name | (4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl) but-3-enoate |
|---|---|
| PubChem CID | 57416202 |
| Molecular Formula | C10H17BO4 |
| Molecular Weight | 212.05 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl) but-3-enoate |
| SMILES | C=CCC(=O)OB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C10H17BO4/c1-6-7-8(12)13-11-14-9(2,3)10(4,5)15-11/h6H,1,7H2,2-5H3 |
| InChIKey | CEGVDFWIYAGJBC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.05 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|