C16H30BO5P — CID 132517398
2-[(2Z)-3-diethoxyphosphorylhexa-2,5-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 132517398) has the molecular formula C16H30BO5P and a molecular weight of 344.20 g/mol. Its IUPAC name is 2-[(2Z)-3-diethoxyphosphorylhexa-2,5-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(2Z)-3-diethoxyphosphorylhexa-2,5-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 132517398 |
| Molecular Formula | C16H30BO5P |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 2-[(2Z)-3-diethoxyphosphorylhexa-2,5-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=CC/C(=C(/C)B1OC(C)(C)C(C)(C)O1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C16H30BO5P/c1-9-12-14(23(18,19-10-2)20-11-3)13(4)17-21-15(5,6)16(7,8)22-17/h9H,1,10-12H2,2-8H3/b14-13+ |
| InChIKey | PTGQXZGHDDSHFX-BUHFOSPRSA-N |
| XLogP | 4.73 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|