C11H21O3P — CID 134988838
(3E)-3-diethoxyphosphoryl-4-methylhexa-1,3-diene (PubChem CID 134988838) has the molecular formula C11H21O3P and a molecular weight of 232.26 g/mol. Its IUPAC name is (3E)-3-diethoxyphosphoryl-4-methylhexa-1,3-diene.
| Compound Name | (3E)-3-diethoxyphosphoryl-4-methylhexa-1,3-diene |
|---|---|
| PubChem CID | 134988838 |
| Molecular Formula | C11H21O3P |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (3E)-3-diethoxyphosphoryl-4-methylhexa-1,3-diene |
| SMILES | C=C/C(=C(/C)CC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C11H21O3P/c1-6-10(5)11(7-2)15(12,13-8-3)14-9-4/h7H,2,6,8-9H2,1,3-5H3/b11-10+ |
| InChIKey | GLNHHYZLXIHOJD-ZHACJKMWSA-N |
| XLogP | 4.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|