C13H23BO4 — CID 134860416
methyl (4S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enoate (PubChem CID 134860416) has the molecular formula C13H23BO4 and a molecular weight of 254.13 g/mol. Its IUPAC name is methyl (4S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enoate.
| Compound Name | methyl (4S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enoate |
|---|---|
| PubChem CID | 134860416 |
| Molecular Formula | C13H23BO4 |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | methyl (4S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enoate |
| SMILES | C=C[C@H](CCC(=O)OC)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H23BO4/c1-7-10(8-9-11(15)16-6)14-17-12(2,3)13(4,5)18-14/h7,10H,1,8-9H2,2-6H3/t10-/m1/s1 |
| InChIKey | AVXRDCQJLYORHU-SNVBAGLBSA-N |
| XLogP | 2.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|