C17H30BFO4 — CID 162624154
methyl (Z)-10-fluoro-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-9-enoate (PubChem CID 162624154) has the molecular formula C17H30BFO4 and a molecular weight of 328.23 g/mol. Its IUPAC name is methyl (Z)-10-fluoro-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-9-enoate.
| Compound Name | methyl (Z)-10-fluoro-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-9-enoate |
|---|---|
| PubChem CID | 162624154 |
| Molecular Formula | C17H30BFO4 |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | methyl (Z)-10-fluoro-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-9-enoate |
| SMILES | COC(=O)CCCCCCC/C=C(\F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H30BFO4/c1-16(2)17(3,4)23-18(22-16)14(19)12-10-8-6-7-9-11-13-15(20)21-5/h12H,6-11,13H2,1-5H3/b14-12- |
| InChIKey | CPMXHBSKOAOUHJ-OWBHPGMISA-N |
| XLogP | 4.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|