C22H29BO3 — CID 102503580
2-[(1R,2R)-1-(4-methoxyphenyl)-1-phenylpropan-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 102503580) has the molecular formula C22H29BO3 and a molecular weight of 352.28 g/mol. Its IUPAC name is 2-[(1R,2R)-1-(4-methoxyphenyl)-1-phenylpropan-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(1R,2R)-1-(4-methoxyphenyl)-1-phenylpropan-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102503580 |
| Molecular Formula | C22H29BO3 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 2-[(1R,2R)-1-(4-methoxyphenyl)-1-phenylpropan-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | COc1ccc([C@@H](c2ccccc2)[C@@H](C)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C22H29BO3/c1-16(23-25-21(2,3)22(4,5)26-23)20(17-10-8-7-9-11-17)18-12-14-19(24-6)15-13-18/h7-16,20H,1-6H3/t16-,20-/m1/s1 |
| InChIKey | RUOMYCORMRRHHC-OXQOHEQNSA-N |
| XLogP | 5.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|