C28H32BO4P — CID 175870467
2-[3-diphenylphosphoryl-3-(4-methoxyphenyl)prop-1-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 175870467) has the molecular formula C28H32BO4P and a molecular weight of 474.35 g/mol. Its IUPAC name is 2-[3-diphenylphosphoryl-3-(4-methoxyphenyl)prop-1-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-diphenylphosphoryl-3-(4-methoxyphenyl)prop-1-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 175870467 |
| Molecular Formula | C28H32BO4P |
| Molecular Weight | 474.35 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 2-[3-diphenylphosphoryl-3-(4-methoxyphenyl)prop-1-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C(B1OC(C)(C)C(C)(C)O1)C(c1ccc(OC)cc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32BO4P/c1-21(29-32-27(2,3)28(4,5)33-29)26(22-17-19-23(31-6)20-18-22)34(30,24-13-9-7-10-14-24)25-15-11-8-12-16-25/h7-20,26H,1H2,2-6H3 |
| InChIKey | CSIZPCCEORCALB-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.35 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|