C25H28BO3PS — CID 168865589
2-(3-diphenylphosphoryl-3-thiophen-3-ylprop-1-en-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 168865589) has the molecular formula C25H28BO3PS and a molecular weight of 450.35 g/mol. Its IUPAC name is 2-(3-diphenylphosphoryl-3-thiophen-3-ylprop-1-en-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(3-diphenylphosphoryl-3-thiophen-3-ylprop-1-en-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 168865589 |
| Molecular Formula | C25H28BO3PS |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-(3-diphenylphosphoryl-3-thiophen-3-ylprop-1-en-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C(B1OC(C)(C)C(C)(C)O1)C(c1ccsc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28BO3PS/c1-19(26-28-24(2,3)25(4,5)29-26)23(20-16-17-31-18-20)30(27,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-18,23H,1H2,2-5H3 |
| InChIKey | NRLJXZVIGGNDNS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|