C27H40BO3P — CID 134952964
2-[(3R)-2-diphenylphosphorylnonan-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 134952964) has the molecular formula C27H40BO3P and a molecular weight of 454.40 g/mol. Its IUPAC name is 2-[(3R)-2-diphenylphosphorylnonan-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(3R)-2-diphenylphosphorylnonan-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 134952964 |
| Molecular Formula | C27H40BO3P |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | 2-[(3R)-2-diphenylphosphorylnonan-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCC[C@@H](B1OC(C)(C)C(C)(C)O1)C(C)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H40BO3P/c1-7-8-9-16-21-25(28-30-26(3,4)27(5,6)31-28)22(2)32(29,23-17-12-10-13-18-23)24-19-14-11-15-20-24/h10-15,17-20,22,25H,7-9,16,21H2,1-6H3/t22?,25-/m1/s1 |
| InChIKey | RLWPYQRQHQMGTR-NRWPOFLRSA-N |
| XLogP | 6.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|