C20H35OP — CID 3575781
[butyl(decan-2-yl)phosphoryl]benzene (PubChem CID 3575781) has the molecular formula C20H35OP and a molecular weight of 322.47 g/mol. Its IUPAC name is [butyl(decan-2-yl)phosphoryl]benzene.
| Compound Name | [butyl(decan-2-yl)phosphoryl]benzene |
|---|---|
| PubChem CID | 3575781 |
| Molecular Formula | C20H35OP |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | [butyl(decan-2-yl)phosphoryl]benzene |
| SMILES | CCCCCCCCC(C)P(=O)(CCCC)c1ccccc1 |
| InChI | InChI=1S/C20H35OP/c1-4-6-8-9-10-12-15-19(3)22(21,18-7-5-2)20-16-13-11-14-17-20/h11,13-14,16-17,19H,4-10,12,15,18H2,1-3H3 |
| InChIKey | VMURADZEFNJWGI-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|