C24H42NO3P — CID 102456794
2-hydroxy-N,N-bis(2-methylpropyl)-2-[octyl(phenyl)phosphoryl]acetamide (PubChem CID 102456794) has the molecular formula C24H42NO3P and a molecular weight of 423.58 g/mol. Its IUPAC name is 2-hydroxy-N,N-bis(2-methylpropyl)-2-[octyl(phenyl)phosphoryl]acetamide.
| Compound Name | 2-hydroxy-N,N-bis(2-methylpropyl)-2-[octyl(phenyl)phosphoryl]acetamide |
|---|---|
| PubChem CID | 102456794 |
| Molecular Formula | C24H42NO3P |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | 2-hydroxy-N,N-bis(2-methylpropyl)-2-[octyl(phenyl)phosphoryl]acetamide |
| SMILES | CCCCCCCCP(=O)(c1ccccc1)C(O)C(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C24H42NO3P/c1-6-7-8-9-10-14-17-29(28,22-15-12-11-13-16-22)24(27)23(26)25(18-20(2)3)19-21(4)5/h11-13,15-16,20-21,24,27H,6-10,14,17-19H2,1-5H3 |
| InChIKey | ATVMBCGLLQKNCM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|