C20H39BO2 — CID 146168889
2-(7,11-dimethyldodec-10-en-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 146168889) has the molecular formula C20H39BO2 and a molecular weight of 322.34 g/mol. Its IUPAC name is 2-(7,11-dimethyldodec-10-en-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(7,11-dimethyldodec-10-en-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 146168889 |
| Molecular Formula | C20H39BO2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.30 |
| IUPAC Name | 2-(7,11-dimethyldodec-10-en-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCC(B1OC(C)(C)C(C)(C)O1)C(C)CCC=C(C)C |
| InChI | InChI=1S/C20H39BO2/c1-9-10-11-15-18(17(4)14-12-13-16(2)3)21-22-19(5,6)20(7,8)23-21/h13,17-18H,9-12,14-15H2,1-8H3 |
| InChIKey | GXIQSIQYYYXFBK-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|