C23H26NOPSSi — CID 102367102
N-diphenylphosphoryl-1-thiophen-3-yl-2-trimethylsilylbuta-2,3-dien-1-amine (PubChem CID 102367102) has the molecular formula C23H26NOPSSi and a molecular weight of 423.59 g/mol. Its IUPAC name is N-diphenylphosphoryl-1-thiophen-3-yl-2-trimethylsilylbuta-2,3-dien-1-amine.
| Compound Name | N-diphenylphosphoryl-1-thiophen-3-yl-2-trimethylsilylbuta-2,3-dien-1-amine |
|---|---|
| PubChem CID | 102367102 |
| Molecular Formula | C23H26NOPSSi |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | N-diphenylphosphoryl-1-thiophen-3-yl-2-trimethylsilylbuta-2,3-dien-1-amine |
| SMILES | C=C=C(C(NP(=O)(c1ccccc1)c1ccccc1)c1ccsc1)[Si](C)(C)C |
| InChI | InChI=1S/C23H26NOPSSi/c1-5-22(28(2,3)4)23(19-16-17-27-18-19)24-26(25,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-18,23H,1H2,2-4H3,(H,24,25) |
| InChIKey | SMGWAAXJPWDSLY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|