C19H15OPS — CID 168865599
3-(1-diphenylphosphorylpropa-1,2-dienyl)thiophene (PubChem CID 168865599) has the molecular formula C19H15OPS and a molecular weight of 322.37 g/mol. Its IUPAC name is 3-(1-diphenylphosphorylpropa-1,2-dienyl)thiophene.
| Compound Name | 3-(1-diphenylphosphorylpropa-1,2-dienyl)thiophene |
|---|---|
| PubChem CID | 168865599 |
| Molecular Formula | C19H15OPS |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 3-(1-diphenylphosphorylpropa-1,2-dienyl)thiophene |
| SMILES | C=C=C(c1ccsc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H15OPS/c1-2-19(16-13-14-22-15-16)21(20,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-15H,1H2 |
| InChIKey | OHVHDUZTDBJOBV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|