C22H19O2P — CID 175870456
1-(1-diphenylphosphorylpropa-1,2-dienyl)-3-methoxybenzene (PubChem CID 175870456) has the molecular formula C22H19O2P and a molecular weight of 346.37 g/mol. Its IUPAC name is 1-(1-diphenylphosphorylpropa-1,2-dienyl)-3-methoxybenzene.
| Compound Name | 1-(1-diphenylphosphorylpropa-1,2-dienyl)-3-methoxybenzene |
|---|---|
| PubChem CID | 175870456 |
| Molecular Formula | C22H19O2P |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1-(1-diphenylphosphorylpropa-1,2-dienyl)-3-methoxybenzene |
| SMILES | C=C=C(c1cccc(OC)c1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19O2P/c1-3-22(18-11-10-12-19(17-18)24-2)25(23,20-13-6-4-7-14-20)21-15-8-5-9-16-21/h4-17H,1H2,2H3 |
| InChIKey | XUFGEHPVTQHZPL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|