C19H21O2P — CID 164513905
1-methoxy-3-[1-phenylpropa-1,2-dienyl(propan-2-yl)phosphoryl]benzene (PubChem CID 164513905) has the molecular formula C19H21O2P and a molecular weight of 312.35 g/mol. Its IUPAC name is 1-methoxy-3-[1-phenylpropa-1,2-dienyl(propan-2-yl)phosphoryl]benzene.
| Compound Name | 1-methoxy-3-[1-phenylpropa-1,2-dienyl(propan-2-yl)phosphoryl]benzene |
|---|---|
| PubChem CID | 164513905 |
| Molecular Formula | C19H21O2P |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-methoxy-3-[1-phenylpropa-1,2-dienyl(propan-2-yl)phosphoryl]benzene |
| SMILES | C=C=C(c1ccccc1)[P@@](=O)(c1cccc(OC)c1)C(C)C |
| InChI | InChI=1S/C19H21O2P/c1-5-19(16-10-7-6-8-11-16)22(20,15(2)3)18-13-9-12-17(14-18)21-4/h6-15H,1H2,2-4H3/t22-/m0/s1 |
| InChIKey | ZQUQTHNPVXXTOH-QFIPXVFZSA-N |
| XLogP | 4.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|