C16H17NO3S2 — CID 18793946
2-[(2-benzyl-3-sulfanylpropanoyl)amino]-2-thiophen-3-ylacetic acid (PubChem CID 18793946) has the molecular formula C16H17NO3S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-[(2-benzyl-3-sulfanylpropanoyl)amino]-2-thiophen-3-ylacetic acid.
| Compound Name | 2-[(2-benzyl-3-sulfanylpropanoyl)amino]-2-thiophen-3-ylacetic acid |
|---|---|
| PubChem CID | 18793946 |
| Molecular Formula | C16H17NO3S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-[(2-benzyl-3-sulfanylpropanoyl)amino]-2-thiophen-3-ylacetic acid |
| SMILES | O=C(NC(C(=O)O)c1ccsc1)C(CS)Cc1ccccc1 |
| InChI | InChI=1S/C16H17NO3S2/c18-15(13(9-21)8-11-4-2-1-3-5-11)17-14(16(19)20)12-6-7-22-10-12/h1-7,10,13-14,21H,8-9H2,(H,17,18)(H,19,20) |
| InChIKey | VOYXAVSQQUGNFH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|