C26H27NO4S — CID 139878647
2-(3-phenylmethoxyphenyl)-2-[[4-phenyl-2-(sulfanylmethyl)butanoyl]amino]acetic acid (PubChem CID 139878647) has the molecular formula C26H27NO4S and a molecular weight of 449.57 g/mol. Its IUPAC name is 2-(3-phenylmethoxyphenyl)-2-[[4-phenyl-2-(sulfanylmethyl)butanoyl]amino]acetic acid.
| Compound Name | 2-(3-phenylmethoxyphenyl)-2-[[4-phenyl-2-(sulfanylmethyl)butanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 139878647 |
| Molecular Formula | C26H27NO4S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 2-(3-phenylmethoxyphenyl)-2-[[4-phenyl-2-(sulfanylmethyl)butanoyl]amino]acetic acid |
| SMILES | O=C(NC(C(=O)O)c1cccc(OCc2ccccc2)c1)C(CS)CCc1ccccc1 |
| InChI | InChI=1S/C26H27NO4S/c28-25(22(18-32)15-14-19-8-3-1-4-9-19)27-24(26(29)30)21-12-7-13-23(16-21)31-17-20-10-5-2-6-11-20/h1-13,16,22,24,32H,14-15,17-18H2,(H,27,28)(H,29,30) |
| InChIKey | BWUOFABPUHUDNZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|