C33H33NO5S — CID 22120800
2-[4-[(4-phenylmethoxyphenyl)methoxy]-N-[4-phenyl-2-(sulfanylmethyl)butanoyl]anilino]acetic acid (PubChem CID 22120800) has the molecular formula C33H33NO5S and a molecular weight of 555.70 g/mol. Its IUPAC name is 2-[4-[(4-phenylmethoxyphenyl)methoxy]-N-[4-phenyl-2-(sulfanylmethyl)butanoyl]anilino]acetic acid.
| Compound Name | 2-[4-[(4-phenylmethoxyphenyl)methoxy]-N-[4-phenyl-2-(sulfanylmethyl)butanoyl]anilino]acetic acid |
|---|---|
| PubChem CID | 22120800 |
| Molecular Formula | C33H33NO5S |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | 2-[4-[(4-phenylmethoxyphenyl)methoxy]-N-[4-phenyl-2-(sulfanylmethyl)butanoyl]anilino]acetic acid |
| SMILES | O=C(O)CN(C(=O)C(CS)CCc1ccccc1)c1ccc(OCc2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C33H33NO5S/c35-32(36)21-34(33(37)28(24-40)14-11-25-7-3-1-4-8-25)29-15-19-31(20-16-29)39-23-27-12-17-30(18-13-27)38-22-26-9-5-2-6-10-26/h1-10,12-13,15-20,28,40H,11,14,21-24H2,(H,35,36) |
| InChIKey | FQVNJLGWZTWECF-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|