C25H25NO4S — CID 22120802
2-(2-phenoxy-N-[4-phenyl-2-(sulfanylmethyl)butanoyl]anilino)acetic acid (PubChem CID 22120802) has the molecular formula C25H25NO4S and a molecular weight of 435.55 g/mol. Its IUPAC name is 2-(2-phenoxy-N-[4-phenyl-2-(sulfanylmethyl)butanoyl]anilino)acetic acid.
| Compound Name | 2-(2-phenoxy-N-[4-phenyl-2-(sulfanylmethyl)butanoyl]anilino)acetic acid |
|---|---|
| PubChem CID | 22120802 |
| Molecular Formula | C25H25NO4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-(2-phenoxy-N-[4-phenyl-2-(sulfanylmethyl)butanoyl]anilino)acetic acid |
| SMILES | O=C(O)CN(C(=O)C(CS)CCc1ccccc1)c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C25H25NO4S/c27-24(28)17-26(25(29)20(18-31)16-15-19-9-3-1-4-10-19)22-13-7-8-14-23(22)30-21-11-5-2-6-12-21/h1-14,20,31H,15-18H2,(H,27,28) |
| InChIKey | GIMNEZWGKNPUMO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|