C30H30F3NO6S — CID 20638536
methyl 2-[N-[(2R)-2-(acetylsulfanylmethyl)-4-phenylbutanoyl]-4-[[4-(trifluoromethoxy)phenyl]methoxy]anilino]acetate (PubChem CID 20638536) has the molecular formula C30H30F3NO6S and a molecular weight of 589.63 g/mol. Its IUPAC name is methyl 2-[N-[(2R)-2-(acetylsulfanylmethyl)-4-phenylbutanoyl]-4-[[4-(trifluoromethoxy)phenyl]methoxy]anilino]acetate.
| Compound Name | methyl 2-[N-[(2R)-2-(acetylsulfanylmethyl)-4-phenylbutanoyl]-4-[[4-(trifluoromethoxy)phenyl]methoxy]anilino]acetate |
|---|---|
| PubChem CID | 20638536 |
| Molecular Formula | C30H30F3NO6S |
| Molecular Weight | 589.63 g/mol |
| Exact Mass | 589.17 |
| IUPAC Name | methyl 2-[N-[(2R)-2-(acetylsulfanylmethyl)-4-phenylbutanoyl]-4-[[4-(trifluoromethoxy)phenyl]methoxy]anilino]acetate |
| SMILES | COC(=O)CN(C(=O)[C@@H](CCc1ccccc1)CSC(C)=O)c1ccc(OCc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H30F3NO6S/c1-21(35)41-20-24(11-8-22-6-4-3-5-7-22)29(37)34(18-28(36)38-2)25-12-16-26(17-13-25)39-19-23-9-14-27(15-10-23)40-30(31,32)33/h3-7,9-10,12-17,24H,8,11,18-20H2,1-2H3/t24-/m0/s1 |
| InChIKey | OGLRNASJDTWOMS-DEOSSOPVSA-N |
| XLogP | 6.20 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.63 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|